C20H23NO5S — CID 24796055
dimethyl-[1-[(3-oxo-1,2-dihydroinden-2-yl)oxy]ethylidene]azanium;4-methylbenzenesulfonate (PubChem CID 24796055) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is dimethyl-[1-[(3-oxo-1,2-dihydroinden-2-yl)oxy]ethylidene]azanium;4-methylbenzenesulfonate.
| Compound Name | dimethyl-[1-[(3-oxo-1,2-dihydroinden-2-yl)oxy]ethylidene]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24796055 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | dimethyl-[1-[(3-oxo-1,2-dihydroinden-2-yl)oxy]ethylidene]azanium;4-methylbenzenesulfonate |
| SMILES | CC(OC1Cc2ccccc2C1=O)=[N+](C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H16NO2.C7H8O3S/c1-9(14(2)3)16-12-8-10-6-4-5-7-11(10)13(12)15;1-6-2-4-7(5-3-6)11(8,9)10/h4-7,12H,8H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | CTXQRBRSMXTARQ-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|