C16H12ClNO2 — CID 155548818
(2Z)-2-[(2-chlorophenyl)methylidene]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 155548818) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 155548818 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)/C(=C/c2ccccc2Cl)Oc2ccccc21 |
| InChI | InChI=1S/C16H12ClNO2/c1-18-13-8-4-5-9-14(13)20-15(16(18)19)10-11-6-2-3-7-12(11)17/h2-10H,1H3/b15-10- |
| InChIKey | OSUZIVVZBAVWLE-GDNBJRDFSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|