C21H21NO2 — CID 145210312
3-[4-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]phenyl]propan-1-ol (PubChem CID 145210312) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[4-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]phenyl]propan-1-ol.
| Compound Name | 3-[4-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 145210312 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-[4-[2,3-bis(ethenyl)-1,4-benzoxazin-4-yl]phenyl]propan-1-ol |
| SMILES | C=CC1=C(C=C)N(c2ccc(CCCO)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C21H21NO2/c1-3-18-20(4-2)24-21-10-6-5-9-19(21)22(18)17-13-11-16(12-14-17)8-7-15-23/h3-6,9-14,23H,1-2,7-8,15H2 |
| InChIKey | YRQAFRAWCLQJRA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |