C25H20N4O — CID 144936377
aniline;10-(3,4-diiminocyclohexa-1,5-dien-1-yl)acridin-9-one (PubChem CID 144936377) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is aniline;10-(3,4-diiminocyclohexa-1,5-dien-1-yl)acridin-9-one.
| Compound Name | aniline;10-(3,4-diiminocyclohexa-1,5-dien-1-yl)acridin-9-one |
|---|---|
| PubChem CID | 144936377 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | aniline;10-(3,4-diiminocyclohexa-1,5-dien-1-yl)acridin-9-one |
| SMILES | Nc1ccccc1.[H]/N=C1/C=C(n2c3ccccc3c(=O)c3ccccc32)C=C/C1=N\[H] |
| InChI | InChI=1S/C19H13N3O.C6H7N/c20-15-10-9-12(11-16(15)21)22-17-7-3-1-5-13(17)19(23)14-6-2-4-8-18(14)22;7-6-4-2-1-3-5-6/h1-11,20-21H;1-5H,7H2/b20-15+,21-16-; |
| InChIKey | JBEXWLZCNRIKBG-AOIZJPEBSA-N |
| XLogP | 4.87 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|