C20H14N4O2 — CID 20821728
5,12-diaminoquinolino[2,3-b]acridine-7,14-dione (PubChem CID 20821728) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 5,12-diaminoquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-diaminoquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 20821728 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5,12-diaminoquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Nn1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1ccccc1n3N |
| InChI | InChI=1S/C20H14N4O2/c21-23-15-7-3-1-5-11(15)19(25)13-9-18-14(10-17(13)23)20(26)12-6-2-4-8-16(12)24(18)22/h1-10H,21-22H2 |
| InChIKey | ABIWVMZKBDKOTO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|