C36H48N6O2 — CID 15538503
5,12-bis[6-(2-aminoethylamino)hexyl]quinolino[2,3-b]acridine-7,14-dione (PubChem CID 15538503) has the molecular formula C36H48N6O2 and a molecular weight of 596.82 g/mol. Its IUPAC name is 5,12-bis[6-(2-aminoethylamino)hexyl]quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-bis[6-(2-aminoethylamino)hexyl]quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 15538503 |
| Molecular Formula | C36H48N6O2 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | 5,12-bis[6-(2-aminoethylamino)hexyl]quinolino[2,3-b]acridine-7,14-dione |
| SMILES | NCCNCCCCCCn1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1ccccc1n3CCCCCCNCCN |
| InChI | InChI=1S/C36H48N6O2/c37-17-21-39-19-9-1-3-11-23-41-31-15-7-5-13-27(31)35(43)29-26-34-30(25-33(29)41)36(44)28-14-6-8-16-32(28)42(34)24-12-4-2-10-20-40-22-18-38/h5-8,13-16,25-26,39-40H,1-4,9-12,17-24,37-38H2 |
| InChIKey | HZFPKXMFDWBMCX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|