C30H28N4 — CID 144936357
aniline;N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-4-methyl-N-(4-methylphenyl)naphthalen-1-amine (PubChem CID 144936357) has the molecular formula C30H28N4 and a molecular weight of 444.58 g/mol. Its IUPAC name is aniline;N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-4-methyl-N-(4-methylphenyl)naphthalen-1-amine.
| Compound Name | aniline;N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-4-methyl-N-(4-methylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 144936357 |
| Molecular Formula | C30H28N4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | aniline;N-(3,4-diiminocyclohexa-1,5-dien-1-yl)-4-methyl-N-(4-methylphenyl)naphthalen-1-amine |
| SMILES | Nc1ccccc1.[H]/N=C1/C=C(N(c2ccc(C)cc2)c2ccc(C)c3ccccc23)C=C/C1=N\[H] |
| InChI | InChI=1S/C24H21N3.C6H7N/c1-16-7-10-18(11-8-16)27(19-12-13-22(25)23(26)15-19)24-14-9-17(2)20-5-3-4-6-21(20)24;7-6-4-2-1-3-5-6/h3-15,25-26H,1-2H3;1-5H,7H2/b25-22+,26-23-; |
| InChIKey | OIYZNTHRQFEGEW-ACVVBYOXSA-N |
| XLogP | 7.36 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|