C35H27NO2 — CID 139962476
4-[4-[bis(4-methylnaphthalen-1-yl)amino]phenyl]benzoic acid (PubChem CID 139962476) has the molecular formula C35H27NO2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 4-[4-[bis(4-methylnaphthalen-1-yl)amino]phenyl]benzoic acid.
| Compound Name | 4-[4-[bis(4-methylnaphthalen-1-yl)amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139962476 |
| Molecular Formula | C35H27NO2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-[4-[bis(4-methylnaphthalen-1-yl)amino]phenyl]benzoic acid |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc(C(=O)O)cc3)cc2)c2ccc(C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C35H27NO2/c1-23-11-21-33(31-9-5-3-7-29(23)31)36(34-22-12-24(2)30-8-4-6-10-32(30)34)28-19-17-26(18-20-28)25-13-15-27(16-14-25)35(37)38/h3-22H,1-2H3,(H,37,38) |
| InChIKey | ZCNDFZGXGWWLNB-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |