C50H38N2O2 — CID 139978890
4-[4-[[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]-naphthalen-1-ylamino]phenyl]benzoic acid (PubChem CID 139978890) has the molecular formula C50H38N2O2 and a molecular weight of 698.87 g/mol. Its IUPAC name is 4-[4-[[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]-naphthalen-1-ylamino]phenyl]benzoic acid.
| Compound Name | 4-[4-[[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]-naphthalen-1-ylamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139978890 |
| Molecular Formula | C50H38N2O2 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | 4-[4-[[9,9-dimethyl-7-(N-phenylanilino)fluoren-2-yl]-naphthalen-1-ylamino]phenyl]benzoic acid |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc(N(c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C50H38N2O2/c1-50(2)46-32-41(51(38-14-5-3-6-15-38)39-16-7-4-8-17-39)28-30-44(46)45-31-29-42(33-47(45)50)52(48-19-11-13-36-12-9-10-18-43(36)48)40-26-24-35(25-27-40)34-20-22-37(23-21-34)49(53)54/h3-33H,1-2H3,(H,53,54) |
| InChIKey | BLXFVNCTLUYKIR-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |