C35H29NO2 — CID 139978978
4-[4-(N-(7,9,9-trimethylfluoren-2-yl)anilino)phenyl]benzoic acid (PubChem CID 139978978) has the molecular formula C35H29NO2 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-[4-(N-(7,9,9-trimethylfluoren-2-yl)anilino)phenyl]benzoic acid.
| Compound Name | 4-[4-(N-(7,9,9-trimethylfluoren-2-yl)anilino)phenyl]benzoic acid |
|---|---|
| PubChem CID | 139978978 |
| Molecular Formula | C35H29NO2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-[4-(N-(7,9,9-trimethylfluoren-2-yl)anilino)phenyl]benzoic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(N(c3ccccc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)ccc1-2 |
| InChI | InChI=1S/C35H29NO2/c1-23-9-19-30-31-20-18-29(22-33(31)35(2,3)32(30)21-23)36(27-7-5-4-6-8-27)28-16-14-25(15-17-28)24-10-12-26(13-11-24)34(37)38/h4-22H,1-3H3,(H,37,38) |
| InChIKey | KWAILQXFCHWTNV-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |