C32H25NO2 — CID 139978989
4-[(9,9-dimethylfluoren-2-yl)-naphthalen-2-ylamino]benzoic acid (PubChem CID 139978989) has the molecular formula C32H25NO2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[(9,9-dimethylfluoren-2-yl)-naphthalen-2-ylamino]benzoic acid.
| Compound Name | 4-[(9,9-dimethylfluoren-2-yl)-naphthalen-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 139978989 |
| Molecular Formula | C32H25NO2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[(9,9-dimethylfluoren-2-yl)-naphthalen-2-ylamino]benzoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C(=O)O)cc3)c3ccc4ccccc4c3)cc21 |
| InChI | InChI=1S/C32H25NO2/c1-32(2)29-10-6-5-9-27(29)28-18-17-26(20-30(28)32)33(24-14-12-22(13-15-24)31(34)35)25-16-11-21-7-3-4-8-23(21)19-25/h3-20H,1-2H3,(H,34,35) |
| InChIKey | PWCAUZSTARAMRV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |