C40H33NO2 — CID 139978835
4-[4-[(9,9-dimethylfluoren-2-yl)-(6-ethylnaphthalen-2-yl)amino]phenyl]benzoic acid (PubChem CID 139978835) has the molecular formula C40H33NO2 and a molecular weight of 559.71 g/mol. Its IUPAC name is 4-[4-[(9,9-dimethylfluoren-2-yl)-(6-ethylnaphthalen-2-yl)amino]phenyl]benzoic acid.
| Compound Name | 4-[4-[(9,9-dimethylfluoren-2-yl)-(6-ethylnaphthalen-2-yl)amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139978835 |
| Molecular Formula | C40H33NO2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 4-[4-[(9,9-dimethylfluoren-2-yl)-(6-ethylnaphthalen-2-yl)amino]phenyl]benzoic acid |
| SMILES | CCc1ccc2cc(N(c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc2c1 |
| InChI | InChI=1S/C40H33NO2/c1-4-26-9-10-31-24-33(20-17-30(31)23-26)41(32-18-15-28(16-19-32)27-11-13-29(14-12-27)39(42)43)34-21-22-36-35-7-5-6-8-37(35)40(2,3)38(36)25-34/h5-25H,4H2,1-3H3,(H,42,43) |
| InChIKey | NBNDXGCGZGYCRA-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |