C25H21NO2 — CID 139957866
4-(4-methyl-N-(5-methylnaphthalen-2-yl)anilino)benzoic acid (PubChem CID 139957866) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-(4-methyl-N-(5-methylnaphthalen-2-yl)anilino)benzoic acid.
| Compound Name | 4-(4-methyl-N-(5-methylnaphthalen-2-yl)anilino)benzoic acid |
|---|---|
| PubChem CID | 139957866 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-(4-methyl-N-(5-methylnaphthalen-2-yl)anilino)benzoic acid |
| SMILES | Cc1ccc(N(c2ccc(C(=O)O)cc2)c2ccc3c(C)cccc3c2)cc1 |
| InChI | InChI=1S/C25H21NO2/c1-17-6-10-21(11-7-17)26(22-12-8-19(9-13-22)25(27)28)23-14-15-24-18(2)4-3-5-20(24)16-23/h3-16H,1-2H3,(H,27,28) |
| InChIKey | CXZJLHYIQBXYOW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |