C14H17N5 — CID 90818970
[7-(aminomethyl)-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazol-6-yl]-methanidylazanium (PubChem CID 90818970) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is [7-(aminomethyl)-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazol-6-yl]-methanidylazanium.
| Compound Name | [7-(aminomethyl)-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazol-6-yl]-methanidylazanium |
|---|---|
| PubChem CID | 90818970 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [7-(aminomethyl)-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazol-6-yl]-methanidylazanium |
| SMILES | [CH2-][NH2+]c1c(CN)c2nc(-c3ccccc3)[nH]n2c1C |
| InChI | InChI=1S/C14H17N5/c1-9-12(16-2)11(8-15)14-17-13(18-19(9)14)10-6-4-3-5-7-10/h3-7H,2,8,15-16H2,1H3,(H,17,18) |
| InChIKey | BTTJVJCPRQVRBU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|