C13H16N2 — CID 82506137
(1,2-dimethyl-5-phenylpyrrol-3-yl)methanamine (PubChem CID 82506137) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (1,2-dimethyl-5-phenylpyrrol-3-yl)methanamine.
| Compound Name | (1,2-dimethyl-5-phenylpyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 82506137 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (1,2-dimethyl-5-phenylpyrrol-3-yl)methanamine |
| SMILES | Cc1c(CN)cc(-c2ccccc2)n1C |
| InChI | InChI=1S/C13H16N2/c1-10-12(9-14)8-13(15(10)2)11-6-4-3-5-7-11/h3-8H,9,14H2,1-2H3 |
| InChIKey | GUEWJXWAYDVXIL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |