C13H14ClNO — CID 116828847
[5-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]methanol (PubChem CID 116828847) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]methanol.
| Compound Name | [5-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 116828847 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
| SMILES | Cc1c(CO)cc(-c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C13H14ClNO/c1-9-11(8-16)7-13(15(9)2)10-3-5-12(14)6-4-10/h3-7,16H,8H2,1-2H3 |
| InChIKey | ZCKVICHGHOPQNZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |