C13H13F2NO — CID 116828876
[5-(2,5-difluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol (PubChem CID 116828876) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is [5-(2,5-difluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol.
| Compound Name | [5-(2,5-difluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 116828876 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [5-(2,5-difluorophenyl)-1,2-dimethylpyrrol-3-yl]methanol |
| SMILES | Cc1c(CO)cc(-c2cc(F)ccc2F)n1C |
| InChI | InChI=1S/C13H13F2NO/c1-8-9(7-17)5-13(16(8)2)11-6-10(14)3-4-12(11)15/h3-6,17H,7H2,1-2H3 |
| InChIKey | CVEOKEJTULFNJG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |