C11H10F2N2S — CID 82159358
[5-(2,5-difluorophenyl)-1-methylpyrazol-3-yl]methanethiol (PubChem CID 82159358) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is [5-(2,5-difluorophenyl)-1-methylpyrazol-3-yl]methanethiol.
| Compound Name | [5-(2,5-difluorophenyl)-1-methylpyrazol-3-yl]methanethiol |
|---|---|
| PubChem CID | 82159358 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [5-(2,5-difluorophenyl)-1-methylpyrazol-3-yl]methanethiol |
| SMILES | Cn1nc(CS)cc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C11H10F2N2S/c1-15-11(5-8(6-16)14-15)9-4-7(12)2-3-10(9)13/h2-5,16H,6H2,1H3 |
| InChIKey | WQYDMCXWXFGKRY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|