C15H13F2N3 — CID 65040476
[2-(2,5-difluorophenyl)-1-methylbenzimidazol-5-yl]methanamine (PubChem CID 65040476) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-1-methylbenzimidazol-5-yl]methanamine.
| Compound Name | [2-(2,5-difluorophenyl)-1-methylbenzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 65040476 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | [2-(2,5-difluorophenyl)-1-methylbenzimidazol-5-yl]methanamine |
| SMILES | Cn1c(-c2cc(F)ccc2F)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C15H13F2N3/c1-20-14-5-2-9(8-18)6-13(14)19-15(20)11-7-10(16)3-4-12(11)17/h2-7H,8,18H2,1H3 |
| InChIKey | PGMFZFMTVABRGY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |