C15H12F3N3 — CID 65037693
[1-methyl-2-(3,4,5-trifluorophenyl)benzimidazol-5-yl]methanamine (PubChem CID 65037693) has the molecular formula C15H12F3N3 and a molecular weight of 291.28 g/mol. Its IUPAC name is [1-methyl-2-(3,4,5-trifluorophenyl)benzimidazol-5-yl]methanamine.
| Compound Name | [1-methyl-2-(3,4,5-trifluorophenyl)benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 65037693 |
| Molecular Formula | C15H12F3N3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [1-methyl-2-(3,4,5-trifluorophenyl)benzimidazol-5-yl]methanamine |
| SMILES | Cn1c(-c2cc(F)c(F)c(F)c2)nc2cc(CN)ccc21 |
| InChI | InChI=1S/C15H12F3N3/c1-21-13-3-2-8(7-19)4-12(13)20-15(21)9-5-10(16)14(18)11(17)6-9/h2-6H,7,19H2,1H3 |
| InChIKey | OZBRJPVAXGMTRJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|