C18H16ClN — CID 102119447
5-(4-chlorophenyl)-1,3-dimethyl-2-phenylpyrrole (PubChem CID 102119447) has the molecular formula C18H16ClN and a molecular weight of 281.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1,3-dimethyl-2-phenylpyrrole.
| Compound Name | 5-(4-chlorophenyl)-1,3-dimethyl-2-phenylpyrrole |
|---|---|
| PubChem CID | 102119447 |
| Molecular Formula | C18H16ClN |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-(4-chlorophenyl)-1,3-dimethyl-2-phenylpyrrole |
| SMILES | Cc1cc(-c2ccc(Cl)cc2)n(C)c1-c1ccccc1 |
| InChI | InChI=1S/C18H16ClN/c1-13-12-17(14-8-10-16(19)11-9-14)20(2)18(13)15-6-4-3-5-7-15/h3-12H,1-2H3 |
| InChIKey | JENYFMPMJULSDY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |