C10H12N4 — CID 62732620
(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 62732620) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 62732620 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | Cn1nc(-c2ccccc2)nc1CN |
| InChI | InChI=1S/C10H12N4/c1-14-9(7-11)12-10(13-14)8-5-3-2-4-6-8/h2-6H,7,11H2,1H3 |
| InChIKey | QJJJZRBQWJEQAW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |