About N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine
N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine (PubChem CID 115277894) has the molecular formula C13H16N4
and a molecular weight of 228.30 g/mol. Its IUPAC name is N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine |
| PubChem CID | 115277894 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nc(-c2ccccc2)nn1C |
| InChI | InChI=1S/C13H16N4/c1-3-9-14-10-12-15-13(16-17(12)2)11-7-5-4-6-8-11/h3-8,14H,1,9-10H2,2H3 |
| InChIKey | SPFWGZJKQMMSBE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine?
The IUPAC name of N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine (CID 115277894) is N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine.
What is the SMILES notation for N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine?
The canonical SMILES for N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine is C=CCNCc1nc(-c2ccccc2)nn1C.
What is the InChIKey of N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine?
The InChIKey is SPFWGZJKQMMSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4/c1-3-9-14-10-12-15-13(16-17(12)2)11-7-5-4-6-8-11/h3-8,14H,1,9-10H2,2H3.
What are the key properties of N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine?
N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine has a molecular weight of 228.30 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]prop-2-en-1-amine is sourced from PubChem (CID 115277894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).