4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid

C13H15N3O2 — CID 62734691

IUPAC4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid
SMILESCn1nc(-c2ccccc2)nc1CCCC(=O)O
InChIInChI=1S/C13H15N3O2/c1-16-11(8-5-9-12(17)18)14-13(15-16)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,17,18)
InChIKeyCOHXVEMZQLSNMG-UHFFFAOYSA-N
MW245.28 g/mol
LogP1.89
Rot. Bonds5

About 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid

4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid (PubChem CID 62734691) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid.

Molecular Properties

Compound Name4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid
PubChem CID62734691
Molecular FormulaC13H15N3O2
Molecular Weight245.28 g/mol
Exact Mass245.12
IUPAC Name4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid
SMILESCn1nc(-c2ccccc2)nc1CCCC(=O)O
InChIInChI=1S/C13H15N3O2/c1-16-11(8-5-9-12(17)18)14-13(15-16)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,17,18)
InChIKeyCOHXVEMZQLSNMG-UHFFFAOYSA-N
XLogP1.89
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid?
The IUPAC name of 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid (CID 62734691) is 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid?
The canonical SMILES for 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid is Cn1nc(-c2ccccc2)nc1CCCC(=O)O.
What is the InChIKey of 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid?
The InChIKey is COHXVEMZQLSNMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-16-11(8-5-9-12(17)18)14-13(15-16)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,17,18).
What are the key properties of 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid?
4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid has a molecular weight of 245.28 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)butanoic acid is sourced from PubChem (CID 62734691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).