C23H19FN6 — CID 177102073
6-amino-4-[3-(6-fluoro-2-pyridinyl)phenyl]-5-isocyano-2-piperidin-1-ylpyridine-3-carbonitrile (PubChem CID 177102073) has the molecular formula C23H19FN6 and a molecular weight of 398.45 g/mol. Its IUPAC name is 6-amino-4-[3-(6-fluoro-2-pyridinyl)phenyl]-5-isocyano-2-piperidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 6-amino-4-[3-(6-fluoro-2-pyridinyl)phenyl]-5-isocyano-2-piperidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 177102073 |
| Molecular Formula | C23H19FN6 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6-amino-4-[3-(6-fluoro-2-pyridinyl)phenyl]-5-isocyano-2-piperidin-1-ylpyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(N)nc(N2CCCCC2)c(C#N)c1-c1cccc(-c2cccc(F)n2)c1 |
| InChI | InChI=1S/C23H19FN6/c1-27-21-20(16-8-5-7-15(13-16)18-9-6-10-19(24)28-18)17(14-25)23(29-22(21)26)30-11-3-2-4-12-30/h5-10,13H,2-4,11-12H2,(H2,26,29) |
| InChIKey | SAICPAARBAOLOX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|