C24H21N5O3 — CID 91415868
2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl 2-amino-3-phenylpropanoate (PubChem CID 91415868) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl 2-amino-3-phenylpropanoate.
| Compound Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 91415868 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl 2-amino-3-phenylpropanoate |
| SMILES | N#Cc1c(N)nc(OCCOC(=O)C(N)Cc2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C24H21N5O3/c25-14-18-21(17-9-5-2-6-10-17)19(15-26)23(29-22(18)28)31-11-12-32-24(30)20(27)13-16-7-3-1-4-8-16/h1-10,20H,11-13,27H2,(H2,28,29) |
| InChIKey | AVPOAFTUNBVAIC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 148.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|