C28H27N5O5 — CID 91251036
2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 91251036) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 91251036 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCOc1nc(N)c(C#N)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C28H27N5O5/c1-18(2)24(32-28(35)38-17-19-9-5-3-6-10-19)27(34)37-14-13-36-26-22(16-30)23(20-11-7-4-8-12-20)21(15-29)25(31)33-26/h3-12,18,24H,13-14,17H2,1-2H3,(H2,31,33)(H,32,35)/t24-/m0/s1 |
| InChIKey | GOQTZFADZZCXJV-DEOSSOPVSA-N |
| XLogP | 3.95 |
| TPSA | 160.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|