About 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate
2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 12972735) has the molecular formula C24H21N5O3
and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate |
| PubChem CID | 12972735 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | N#Cc1c(N)nc(OCCOC(=O)[C@@H](N)Cc2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C24H21N5O3/c25-14-18-21(17-9-5-2-6-10-17)19(15-26)23(29-22(18)28)31-11-12-32-24(30)20(27)13-16-7-3-1-4-8-16/h1-10,20H,11-13,27H2,(H2,28,29)/t20-/m0/s1 |
| InChIKey | AVPOAFTUNBVAIC-FQEVSTJZSA-N |
| XLogP | 2.57 |
| TPSA | 148.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate?
The IUPAC name of 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate (CID 12972735) is 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate.
What is the SMILES notation for 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate?
The canonical SMILES for 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate is N#Cc1c(N)nc(OCCOC(=O)[C@@H](N)Cc2ccccc2)c(C#N)c1-c1ccccc1.
What is the InChIKey of 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate?
The InChIKey is AVPOAFTUNBVAIC-FQEVSTJZSA-N. The full InChI is InChI=1S/C24H21N5O3/c25-14-18-21(17-9-5-2-6-10-17)19(15-26)23(29-22(18)28)31-11-12-32-24(30)20(27)13-16-7-3-1-4-8-16/h1-10,20H,11-13,27H2,(H2,28,29)/t20-/m0/s1.
What are the key properties of 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate?
2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate has a molecular weight of 427.46 g/mol, XLogP of 2.57, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)oxy]ethyl (2S)-2-amino-3-phenylpropanoate is sourced from PubChem (CID 12972735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).