C21H21N5O — CID 169398347
2,4-diamino-6-[4-(4-tert-butylphenoxy)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169398347) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,4-diamino-6-[4-(4-tert-butylphenoxy)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[4-(4-tert-butylphenoxy)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398347 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2,4-diamino-6-[4-(4-tert-butylphenoxy)phenyl]pyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(-c3nc(N)nc(N)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C21H21N5O/c1-21(2,3)14-6-10-16(11-7-14)27-15-8-4-13(5-9-15)18-17(12-22)19(23)26-20(24)25-18/h4-11H,1-3H3,(H4,23,24,25,26) |
| InChIKey | IKCAITIRWDZXRA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |