C8H9N3O — CID 10725688
5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-amine (PubChem CID 10725688) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-amine.
| Compound Name | 5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-amine |
|---|---|
| PubChem CID | 10725688 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-amine |
| SMILES | COc1ccc2[nH]c(N)cc2n1 |
| InChI | InChI=1S/C8H9N3O/c1-12-8-3-2-5-6(11-8)4-7(9)10-5/h2-4,10H,9H2,1H3 |
| InChIKey | PZILLUKFHQGDOY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |