C15H11N5O — CID 65483661
6-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)quinoxaline (PubChem CID 65483661) has the molecular formula C15H11N5O and a molecular weight of 277.29 g/mol. Its IUPAC name is 6-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)quinoxaline.
| Compound Name | 6-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)quinoxaline |
|---|---|
| PubChem CID | 65483661 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)quinoxaline |
| SMILES | COc1ccc2[nH]c(-c3ccc4nccnc4c3)nc2n1 |
| InChI | InChI=1S/C15H11N5O/c1-21-13-5-4-11-15(19-13)20-14(18-11)9-2-3-10-12(8-9)17-7-6-16-10/h2-8H,1H3,(H,18,19,20) |
| InChIKey | WPYOOSRSVLFWRF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |