C13H9Cl2N3O — CID 65482699
2-(2,5-dichlorophenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 65482699) has the molecular formula C13H9Cl2N3O and a molecular weight of 294.14 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(2,5-dichlorophenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 65482699 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2[nH]c(-c3cc(Cl)ccc3Cl)nc2n1 |
| InChI | InChI=1S/C13H9Cl2N3O/c1-19-11-5-4-10-13(17-11)18-12(16-10)8-6-7(14)2-3-9(8)15/h2-6H,1H3,(H,16,17,18) |
| InChIKey | FOUGMOBKGAPVQQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |