C13H11FN4O — CID 65485203
2-fluoro-5-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)aniline (PubChem CID 65485203) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is 2-fluoro-5-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 2-fluoro-5-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 65485203 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-fluoro-5-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)aniline |
| SMILES | COc1ccc2[nH]c(-c3ccc(F)c(N)c3)nc2n1 |
| InChI | InChI=1S/C13H11FN4O/c1-19-11-5-4-10-13(17-11)18-12(16-10)7-2-3-8(14)9(15)6-7/h2-6H,15H2,1H3,(H,16,17,18) |
| InChIKey | RELYFXJANFAZFE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|