C14H12BrN3O — CID 115999492
2-(3-bromo-5-methylphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 115999492) has the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-(3-bromo-5-methylphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-bromo-5-methylphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 115999492 |
| Molecular Formula | C14H12BrN3O |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-(3-bromo-5-methylphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2[nH]c(-c3cc(C)cc(Br)c3)nc2n1 |
| InChI | InChI=1S/C14H12BrN3O/c1-8-5-9(7-10(15)6-8)13-16-11-3-4-12(19-2)17-14(11)18-13/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | YLUKTRQGQMQMTH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |