C13H9Br2N3 — CID 107972981
2-(3,5-dibromophenyl)-5-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 107972981) has the molecular formula C13H9Br2N3 and a molecular weight of 367.04 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-5-methyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(3,5-dibromophenyl)-5-methyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 107972981 |
| Molecular Formula | C13H9Br2N3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 2-(3,5-dibromophenyl)-5-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc2[nH]c(-c3cc(Br)cc(Br)c3)nc2n1 |
| InChI | InChI=1S/C13H9Br2N3/c1-7-2-3-11-13(16-7)18-12(17-11)8-4-9(14)6-10(15)5-8/h2-6H,1H3,(H,16,17,18) |
| InChIKey | CWQYWESNJHYOJV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |