3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid

C14H11N3O2 — CID 81137604

IUPAC3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid
SMILESCc1ccc2[nH]c(-c3cccc(C(=O)O)c3)nc2n1
InChIInChI=1S/C14H11N3O2/c1-8-5-6-11-13(15-8)17-12(16-11)9-3-2-4-10(7-9)14(18)19/h2-7H,1H3,(H,18,19)(H,15,16,17)
InChIKeyLEOYJMJCGFQGNX-UHFFFAOYSA-N
MW253.26 g/mol
LogP2.63
Rot. Bonds2

About 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid

3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid (PubChem CID 81137604) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid.

Molecular Properties

Compound Name3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid
PubChem CID81137604
Molecular FormulaC14H11N3O2
Molecular Weight253.26 g/mol
Exact Mass253.09
IUPAC Name3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid
SMILESCc1ccc2[nH]c(-c3cccc(C(=O)O)c3)nc2n1
InChIInChI=1S/C14H11N3O2/c1-8-5-6-11-13(15-8)17-12(16-11)9-3-2-4-10(7-9)14(18)19/h2-7H,1H3,(H,18,19)(H,15,16,17)
InChIKeyLEOYJMJCGFQGNX-UHFFFAOYSA-N
XLogP2.63
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.26
LogP ≤ 52.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The IUPAC name of 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid (CID 81137604) is 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid.
What is the SMILES notation for 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The canonical SMILES for 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid is Cc1ccc2[nH]c(-c3cccc(C(=O)O)c3)nc2n1.
What is the InChIKey of 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
The InChIKey is LEOYJMJCGFQGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2/c1-8-5-6-11-13(15-8)17-12(16-11)9-3-2-4-10(7-9)14(18)19/h2-7H,1H3,(H,18,19)(H,15,16,17).
What are the key properties of 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid?
3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid has a molecular weight of 253.26 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1H-imidazo[4,5-b]pyridin-2-yl)benzoic acid is sourced from PubChem (CID 81137604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).