C14H12ClN3 — CID 113360589
2-(4-chloro-3-methylphenyl)-5-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 113360589) has the molecular formula C14H12ClN3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenyl)-5-methyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(4-chloro-3-methylphenyl)-5-methyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 113360589 |
| Molecular Formula | C14H12ClN3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-(4-chloro-3-methylphenyl)-5-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc2[nH]c(-c3ccc(Cl)c(C)c3)nc2n1 |
| InChI | InChI=1S/C14H12ClN3/c1-8-7-10(4-5-11(8)15)13-17-12-6-3-9(2)16-14(12)18-13/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | UGFNVIRIVVPNOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |