C20H15N3O3 — CID 167974159
4-[4-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]benzoic acid (PubChem CID 167974159) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-[4-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]benzoic acid.
| Compound Name | 4-[4-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 167974159 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-[4-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]benzoic acid |
| SMILES | COc1ccc2[nH]c(-c3ccc(-c4ccc(C(=O)O)cc4)cc3)nc2n1 |
| InChI | InChI=1S/C20H15N3O3/c1-26-17-11-10-16-19(22-17)23-18(21-16)14-6-2-12(3-7-14)13-4-8-15(9-5-13)20(24)25/h2-11H,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | VHSKCLUSSXGYET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |