C13H11N3O3 — CID 136903811
2-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,4-diol (PubChem CID 136903811) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,4-diol.
| Compound Name | 2-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 136903811 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,4-diol |
| SMILES | COc1ccc2[nH]c(-c3cc(O)ccc3O)nc2n1 |
| InChI | InChI=1S/C13H11N3O3/c1-19-11-5-3-9-13(15-11)16-12(14-9)8-6-7(17)2-4-10(8)18/h2-6,17-18H,1H3,(H,14,15,16) |
| InChIKey | NCPCRZPRGHYEOJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|