C12H10N4O2 — CID 136812536
3-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyridin-4-one (PubChem CID 136812536) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyridin-4-one.
| Compound Name | 3-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 136812536 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(5-methoxy-1H-imidazo[4,5-b]pyridin-2-yl)-1H-pyridin-4-one |
| SMILES | COc1ccc2[nH]c(-c3c[nH]ccc3=O)nc2n1 |
| InChI | InChI=1S/C12H10N4O2/c1-18-10-3-2-8-12(15-10)16-11(14-8)7-6-13-5-4-9(7)17/h2-6H,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | MUZFDPDSGXRMSP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |