C12H21N3 — CID 156751122
ethane;2-methyl-1H-pyrrolo[3,2-b]pyridin-5-amine (PubChem CID 156751122) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;2-methyl-1H-pyrrolo[3,2-b]pyridin-5-amine.
| Compound Name | ethane;2-methyl-1H-pyrrolo[3,2-b]pyridin-5-amine |
|---|---|
| PubChem CID | 156751122 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;2-methyl-1H-pyrrolo[3,2-b]pyridin-5-amine |
| SMILES | CC.CC.Cc1cc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C8H9N3.2C2H6/c1-5-4-7-6(10-5)2-3-8(9)11-7;2*1-2/h2-4,10H,1H3,(H2,9,11);2*1-2H3 |
| InChIKey | WPSLKGUKMPMCIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |