C22H31N7O3 — CID 162070058
4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine;6-methoxy-2-N-methylpyridine-2,3-diamine (PubChem CID 162070058) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine;6-methoxy-2-N-methylpyridine-2,3-diamine.
| Compound Name | 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine;6-methoxy-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 162070058 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine;6-methoxy-2-N-methylpyridine-2,3-diamine |
| SMILES | CNc1nc(OC)ccc1N.Nc1ccc(OCCCOc2ccc(N)cc2N)c(N)c1 |
| InChI | InChI=1S/C15H20N4O2.C7H11N3O/c16-10-2-4-14(12(18)8-10)20-6-1-7-21-15-5-3-11(17)9-13(15)19;1-9-7-5(8)3-4-6(10-7)11-2/h2-5,8-9H,1,6-7,16-19H2;3-4H,8H2,1-2H3,(H,9,10) |
| InChIKey | ZAYPYAQXRTUCTH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 182.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|