C12H20N4O2 — CID 83121386
3-[2-[(6-methoxy-2-pyridinyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83121386) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[2-[(6-methoxy-2-pyridinyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(6-methoxy-2-pyridinyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121386 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-[2-[(6-methoxy-2-pyridinyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | COc1cccc(CNCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C12H20N4O2/c1-16(2)12(17)14-8-7-13-9-10-5-4-6-11(15-10)18-3/h4-6,13H,7-9H2,1-3H3,(H,14,17) |
| InChIKey | OCKLIDNPYLXQPK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|