C10H15BrN2O — CID 114293547
3-bromo-N-[(6-methoxy-2-pyridinyl)methyl]propan-1-amine (PubChem CID 114293547) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 3-bromo-N-[(6-methoxy-2-pyridinyl)methyl]propan-1-amine.
| Compound Name | 3-bromo-N-[(6-methoxy-2-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114293547 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-bromo-N-[(6-methoxy-2-pyridinyl)methyl]propan-1-amine |
| SMILES | COc1cccc(CNCCCBr)n1 |
| InChI | InChI=1S/C10H15BrN2O/c1-14-10-5-2-4-9(13-10)8-12-7-3-6-11/h2,4-5,12H,3,6-8H2,1H3 |
| InChIKey | SXIBEHRIVFNAKB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|