C12H22N4O2 — CID 106141783
1-[(3-amino-6-methoxy-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106141783) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(3-amino-6-methoxy-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[(3-amino-6-methoxy-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106141783 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-[(3-amino-6-methoxy-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | COc1ccc(N)c(NCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-12(17,8-16(2)3)7-14-11-9(13)5-6-10(15-11)18-4/h5-6,17H,7-8,13H2,1-4H3,(H,14,15) |
| InChIKey | MVRUQPLDHIXUDG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |