C12H22N4O — CID 106141588
1-[(3-amino-6-methyl-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 106141588) has the molecular formula C12H22N4O and a molecular weight of 238.34 g/mol. Its IUPAC name is 1-[(3-amino-6-methyl-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[(3-amino-6-methyl-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106141588 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(3-amino-6-methyl-2-pyridinyl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | Cc1ccc(N)c(NCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C12H22N4O/c1-9-5-6-10(13)11(15-9)14-7-12(2,17)8-16(3)4/h5-6,17H,7-8,13H2,1-4H3,(H,14,15) |
| InChIKey | JNGKAVULKATJBP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |