C14H22N6O — CID 106150386
1-(dimethylamino)-3-[(2-hydrazinylquinazolin-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 106150386) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[(2-hydrazinylquinazolin-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[(2-hydrazinylquinazolin-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106150386 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-(dimethylamino)-3-[(2-hydrazinylquinazolin-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | CN(C)CC(C)(O)CNc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C14H22N6O/c1-14(21,9-20(2)3)8-16-12-10-6-4-5-7-11(10)17-13(18-12)19-15/h4-7,21H,8-9,15H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | GNKGWOBWMITFDN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|