C13H19N5O2 — CID 107868727
2-ethyl-2-[(2-hydrazinylquinazolin-4-yl)amino]propane-1,3-diol (PubChem CID 107868727) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-ethyl-2-[(2-hydrazinylquinazolin-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[(2-hydrazinylquinazolin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 107868727 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-ethyl-2-[(2-hydrazinylquinazolin-4-yl)amino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C13H19N5O2/c1-2-13(7-19,8-20)17-11-9-5-3-4-6-10(9)15-12(16-11)18-14/h3-6,19-20H,2,7-8,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | QATIUPLEKJWEMZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|