C11H14N6O2 — CID 114154625
3-[(2-hydrazinylquinazolin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 114154625) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[(2-hydrazinylquinazolin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(2-hydrazinylquinazolin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 114154625 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-[(2-hydrazinylquinazolin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | NNc1nc(NCC(O)C(N)=O)c2ccccc2n1 |
| InChI | InChI=1S/C11H14N6O2/c12-9(19)8(18)5-14-10-6-3-1-2-4-7(6)15-11(16-10)17-13/h1-4,8,18H,5,13H2,(H2,12,19)(H2,14,15,16,17) |
| InChIKey | PYCBSTHBAHQUMM-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|