C7H11BrN6O2 — CID 106179503
3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 106179503) has the molecular formula C7H11BrN6O2 and a molecular weight of 291.11 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106179503 |
| Molecular Formula | C7H11BrN6O2 |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | NNc1ncc(Br)c(NCC(O)C(N)=O)n1 |
| InChI | InChI=1S/C7H11BrN6O2/c8-3-1-12-7(14-10)13-6(3)11-2-4(15)5(9)16/h1,4,15H,2,10H2,(H2,9,16)(H2,11,12,13,14) |
| InChIKey | YVNIMFGURLVPIM-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|